C21H23N3OS2 — CID 6159383
12-ethyl-12-methyl-5-[(E)-3-phenylprop-2-enyl]sulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 6159383) has the molecular formula C21H23N3OS2 and a molecular weight of 397.57 g/mol. Its IUPAC name is 12-ethyl-12-methyl-5-[(E)-3-phenylprop-2-enyl]sulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 12-ethyl-12-methyl-5-[(E)-3-phenylprop-2-enyl]sulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 6159383 |
| Molecular Formula | C21H23N3OS2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 12-ethyl-12-methyl-5-[(E)-3-phenylprop-2-enyl]sulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CCC1(C)Cc2c(sc3nc(SC/C=C/c4ccccc4)nc(N)c23)CO1 |
| InChI | InChI=1S/C21H23N3OS2/c1-3-21(2)12-15-16(13-25-21)27-19-17(15)18(22)23-20(24-19)26-11-7-10-14-8-5-4-6-9-14/h4-10H,3,11-13H2,1-2H3,(H2,22,23,24)/b10-7+ |
| InChIKey | ZAFBLPRTYTYXGS-JXMROGBWSA-N |
| XLogP | 5.32 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |