C14H18N2OS3 — CID 919073
(12R)-12-ethyl-12-methyl-3,5-bis(methylsulfanyl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene (PubChem CID 919073) has the molecular formula C14H18N2OS3 and a molecular weight of 326.51 g/mol. Its IUPAC name is (12R)-12-ethyl-12-methyl-3,5-bis(methylsulfanyl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene.
| Compound Name | (12R)-12-ethyl-12-methyl-3,5-bis(methylsulfanyl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 919073 |
| Molecular Formula | C14H18N2OS3 |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (12R)-12-ethyl-12-methyl-3,5-bis(methylsulfanyl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
| SMILES | CC[C@]1(C)Cc2c(sc3nc(SC)nc(SC)c23)CO1 |
| InChI | InChI=1S/C14H18N2OS3/c1-5-14(2)6-8-9(7-17-14)20-12-10(8)11(18-3)15-13(16-12)19-4/h5-7H2,1-4H3/t14-/m1/s1 |
| InChIKey | DXVJYLLAZAQHNQ-CQSZACIVSA-N |
| XLogP | 4.38 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |