C16H22N4O2S2 — CID 7596066
N'-[(12R)-12-ethyl-12-methyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]propanehydrazide (PubChem CID 7596066) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N'-[(12R)-12-ethyl-12-methyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]propanehydrazide.
| Compound Name | N'-[(12R)-12-ethyl-12-methyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]propanehydrazide |
|---|---|
| PubChem CID | 7596066 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N'-[(12R)-12-ethyl-12-methyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]propanehydrazide |
| SMILES | CCC(=O)NNc1nc(SC)nc2sc3c(c12)C[C@@](C)(CC)OC3 |
| InChI | InChI=1S/C16H22N4O2S2/c1-5-11(21)19-20-13-12-9-7-16(3,6-2)22-8-10(9)24-14(12)18-15(17-13)23-4/h5-8H2,1-4H3,(H,19,21)(H,17,18,20)/t16-/m1/s1 |
| InChIKey | RBIYOOPQVCAVMH-MRXNPFEDSA-N |
| XLogP | 3.51 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|