C24H30N4O3S2 — CID 41075492
4-butoxy-N'-[(12S)-12-ethyl-12-methyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzohydrazide (PubChem CID 41075492) has the molecular formula C24H30N4O3S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 4-butoxy-N'-[(12S)-12-ethyl-12-methyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzohydrazide.
| Compound Name | 4-butoxy-N'-[(12S)-12-ethyl-12-methyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 41075492 |
| Molecular Formula | C24H30N4O3S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 4-butoxy-N'-[(12S)-12-ethyl-12-methyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNc2nc(SC)nc3sc4c(c23)C[C@](C)(CC)OC4)cc1 |
| InChI | InChI=1S/C24H30N4O3S2/c1-5-7-12-30-16-10-8-15(9-11-16)21(29)28-27-20-19-17-13-24(3,6-2)31-14-18(17)33-22(19)26-23(25-20)32-4/h8-11H,5-7,12-14H2,1-4H3,(H,28,29)(H,25,26,27)/t24-/m0/s1 |
| InChIKey | GGFMDUCGMRLONZ-DEOSSOPVSA-N |
| XLogP | 5.59 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|