About 1-phenylethyl methanimidate
1-phenylethyl methanimidate (PubChem CID 20653459) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 1-phenylethyl methanimidate.
Molecular Properties
| Compound Name | 1-phenylethyl methanimidate |
| PubChem CID | 20653459 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 1-phenylethyl methanimidate |
| SMILES | [H]/N=C/OC(C)c1ccccc1 |
| InChI | InChI=1S/C9H11NO/c1-8(11-7-10)9-5-3-2-4-6-9/h2-8,10H,1H3/b10-7+ |
| InChIKey | COBKNMVRKIWMBT-JXMROGBWSA-N |
| XLogP | 2.37 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethyl methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl methanimidate?
The IUPAC name of 1-phenylethyl methanimidate (CID 20653459) is 1-phenylethyl methanimidate.
What is the SMILES notation for 1-phenylethyl methanimidate?
The canonical SMILES for 1-phenylethyl methanimidate is [H]/N=C/OC(C)c1ccccc1.
What is the InChIKey of 1-phenylethyl methanimidate?
The InChIKey is COBKNMVRKIWMBT-JXMROGBWSA-N. The full InChI is InChI=1S/C9H11NO/c1-8(11-7-10)9-5-3-2-4-6-9/h2-8,10H,1H3/b10-7+.
What are the key properties of 1-phenylethyl methanimidate?
1-phenylethyl methanimidate has a molecular weight of 149.19 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl methanimidate is sourced from PubChem (CID 20653459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).