C27H32N2O6 — CID 20655663
N'-[4-(6-methoxyhexoxy)benzoyl]-6-(methylperoxymethyl)naphthalene-2-carbohydrazide (PubChem CID 20655663) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is N'-[4-(6-methoxyhexoxy)benzoyl]-6-(methylperoxymethyl)naphthalene-2-carbohydrazide.
| Compound Name | N'-[4-(6-methoxyhexoxy)benzoyl]-6-(methylperoxymethyl)naphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 20655663 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N'-[4-(6-methoxyhexoxy)benzoyl]-6-(methylperoxymethyl)naphthalene-2-carbohydrazide |
| SMILES | COCCCCCCOc1ccc(C(=O)NNC(=O)c2ccc3cc(COOC)ccc3c2)cc1 |
| InChI | InChI=1S/C27H32N2O6/c1-32-15-5-3-4-6-16-34-25-13-11-21(12-14-25)26(30)28-29-27(31)24-10-9-22-17-20(19-35-33-2)7-8-23(22)18-24/h7-14,17-18H,3-6,15-16,19H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | AUCHBLUNYDSWAF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|