About 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile
5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile (PubChem CID 20655721) has the molecular formula C6H8N2S
and a molecular weight of 140.21 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile.
Analyze 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile?
The IUPAC name of 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile (CID 20655721) is 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile.
What is the SMILES notation for 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile?
The canonical SMILES for 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile is CC1=C(C#N)SCCN1.
What is the InChIKey of 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile?
The InChIKey is LEHWSRQXYLLCMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S/c1-5-6(4-7)9-3-2-8-5/h8H,2-3H2,1H3.
What are the key properties of 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile?
5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile has a molecular weight of 140.21 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,4-dihydro-2H-1,4-thiazine-6-carbonitrile is sourced from PubChem (CID 20655721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).