C15H27N3O5 — CID 20659285
2-[[2-[2-(diethylamino)ethoxy]-2-oxoethyl]carbamoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 20659285) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[[2-[2-(diethylamino)ethoxy]-2-oxoethyl]carbamoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2-[2-(diethylamino)ethoxy]-2-oxoethyl]carbamoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20659285 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-[[2-[2-(diethylamino)ethoxy]-2-oxoethyl]carbamoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCC(=O)OCCN(CC)CC |
| InChI | InChI=1S/C15H27N3O5/c1-5-18(6-2)8-10-22-13(19)11-17-15(21)16-7-9-23-14(20)12(3)4/h3,5-11H2,1-2,4H3,(H2,16,17,21) |
| InChIKey | POUGEJJHZJGYGG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|