C25H34O2 — CID 20660353
2-methyl-3-[3,4,5-trimethyl-2-(2,3,4,5,6-pentamethylphenyl)phenyl]butanoic acid (PubChem CID 20660353) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 2-methyl-3-[3,4,5-trimethyl-2-(2,3,4,5,6-pentamethylphenyl)phenyl]butanoic acid.
| Compound Name | 2-methyl-3-[3,4,5-trimethyl-2-(2,3,4,5,6-pentamethylphenyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 20660353 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 2-methyl-3-[3,4,5-trimethyl-2-(2,3,4,5,6-pentamethylphenyl)phenyl]butanoic acid |
| SMILES | Cc1cc(C(C)C(C)C(=O)O)c(-c2c(C)c(C)c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C25H34O2/c1-12-11-22(17(6)21(10)25(26)27)24(18(7)13(12)2)23-19(8)15(4)14(3)16(5)20(23)9/h11,17,21H,1-10H3,(H,26,27) |
| InChIKey | ZYKOJQMJZKRVBO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |