C30H42O4 — CID 54419166
diethyl 2-methyl-2-[1-[3,4,5-trimethyl-2-(2,3,4,5,6-pentamethylphenyl)phenyl]ethyl]propanedioate (PubChem CID 54419166) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is diethyl 2-methyl-2-[1-[3,4,5-trimethyl-2-(2,3,4,5,6-pentamethylphenyl)phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-methyl-2-[1-[3,4,5-trimethyl-2-(2,3,4,5,6-pentamethylphenyl)phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 54419166 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | diethyl 2-methyl-2-[1-[3,4,5-trimethyl-2-(2,3,4,5,6-pentamethylphenyl)phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)C(C)c1cc(C)c(C)c(C)c1-c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C30H42O4/c1-13-33-28(31)30(12,29(32)34-14-2)24(11)25-15-16(3)17(4)21(8)27(25)26-22(9)19(6)18(5)20(7)23(26)10/h15,24H,13-14H2,1-12H3 |
| InChIKey | VZOSETZUXSRAJO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|