C18H30O3 — CID 20661392
1,3,5-tris(ethenoxymethyl)-1,3,5-trimethylcyclohexane (PubChem CID 20661392) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1,3,5-tris(ethenoxymethyl)-1,3,5-trimethylcyclohexane.
| Compound Name | 1,3,5-tris(ethenoxymethyl)-1,3,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 20661392 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 1,3,5-tris(ethenoxymethyl)-1,3,5-trimethylcyclohexane |
| SMILES | C=COCC1(C)CC(C)(COC=C)CC(C)(COC=C)C1 |
| InChI | InChI=1S/C18H30O3/c1-7-19-13-16(4)10-17(5,14-20-8-2)12-18(6,11-16)15-21-9-3/h7-9H,1-3,10-15H2,4-6H3 |
| InChIKey | DTGGGYDCQIHQKA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|