About 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane
2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane (PubChem CID 20662326) has the molecular formula C11H22OS
and a molecular weight of 202.36 g/mol. Its IUPAC name is 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane.
Analyze 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane?
The IUPAC name of 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane (CID 20662326) is 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane.
What is the SMILES notation for 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane?
The canonical SMILES for 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane is COCC1SC(C(C)C)C(C)C1C.
What is the InChIKey of 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane?
The InChIKey is UYNPITADNKUEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22OS/c1-7(2)11-9(4)8(3)10(13-11)6-12-5/h7-11H,6H2,1-5H3.
What are the key properties of 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane?
2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane has a molecular weight of 202.36 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-3,4-dimethyl-5-propan-2-ylthiolane is sourced from PubChem (CID 20662326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).