About methyl 2-oxoethyl carbonate
methyl 2-oxoethyl carbonate (PubChem CID 20662885) has the molecular formula C4H6O4
and a molecular weight of 118.09 g/mol. Its IUPAC name is methyl 2-oxoethyl carbonate.
Molecular Properties
| Compound Name | methyl 2-oxoethyl carbonate |
| PubChem CID | 20662885 |
| Molecular Formula | C4H6O4 |
| Molecular Weight | 118.09 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | methyl 2-oxoethyl carbonate |
| SMILES | COC(=O)OCC=O |
| InChI | InChI=1S/C4H6O4/c1-7-4(6)8-3-2-5/h2H,3H2,1H3 |
| InChIKey | RMJLTUIHDMXZSL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.09 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-oxoethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxoethyl carbonate?
The IUPAC name of methyl 2-oxoethyl carbonate (CID 20662885) is methyl 2-oxoethyl carbonate.
What is the SMILES notation for methyl 2-oxoethyl carbonate?
The canonical SMILES for methyl 2-oxoethyl carbonate is COC(=O)OCC=O.
What is the InChIKey of methyl 2-oxoethyl carbonate?
The InChIKey is RMJLTUIHDMXZSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4/c1-7-4(6)8-3-2-5/h2H,3H2,1H3.
What are the key properties of methyl 2-oxoethyl carbonate?
methyl 2-oxoethyl carbonate has a molecular weight of 118.09 g/mol, XLogP of -0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxoethyl carbonate is sourced from PubChem (CID 20662885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).