C20H16FNO — CID 20663173
1-[6-(8-fluoro-6-methylnaphthalen-2-yl)-3-pyridinyl]but-3-yn-2-ol (PubChem CID 20663173) has the molecular formula C20H16FNO and a molecular weight of 305.35 g/mol. Its IUPAC name is 1-[6-(8-fluoro-6-methylnaphthalen-2-yl)-3-pyridinyl]but-3-yn-2-ol.
| Compound Name | 1-[6-(8-fluoro-6-methylnaphthalen-2-yl)-3-pyridinyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 20663173 |
| Molecular Formula | C20H16FNO |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[6-(8-fluoro-6-methylnaphthalen-2-yl)-3-pyridinyl]but-3-yn-2-ol |
| SMILES | C#CC(O)Cc1ccc(-c2ccc3cc(C)cc(F)c3c2)nc1 |
| InChI | InChI=1S/C20H16FNO/c1-3-17(23)10-14-4-7-20(22-12-14)16-6-5-15-8-13(2)9-19(21)18(15)11-16/h1,4-9,11-12,17,23H,10H2,2H3 |
| InChIKey | DITWELBGRVFEGE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|