C10H8ClIO2 — CID 20663973
1-(2-chloro-5-iodophenyl)butane-1,3-dione (PubChem CID 20663973) has the molecular formula C10H8ClIO2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 1-(2-chloro-5-iodophenyl)butane-1,3-dione.
| Compound Name | 1-(2-chloro-5-iodophenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 20663973 |
| Molecular Formula | C10H8ClIO2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 321.93 |
| IUPAC Name | 1-(2-chloro-5-iodophenyl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C10H8ClIO2/c1-6(13)4-10(14)8-5-7(12)2-3-9(8)11/h2-3,5H,4H2,1H3 |
| InChIKey | ABJIYPNAYNBZMJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|