C10H9Cl2NaO3 — CID 70426712
sodium;1-(4,5-dichloro-2-hydroxyphenyl)butane-1,3-dione;hydride (PubChem CID 70426712) has the molecular formula C10H9Cl2NaO3 and a molecular weight of 271.07 g/mol. Its IUPAC name is sodium;1-(4,5-dichloro-2-hydroxyphenyl)butane-1,3-dione;hydride.
| Compound Name | sodium;1-(4,5-dichloro-2-hydroxyphenyl)butane-1,3-dione;hydride |
|---|---|
| PubChem CID | 70426712 |
| Molecular Formula | C10H9Cl2NaO3 |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | sodium;1-(4,5-dichloro-2-hydroxyphenyl)butane-1,3-dione;hydride |
| SMILES | CC(=O)CC(=O)c1cc(Cl)c(Cl)cc1O.[H-].[Na+] |
| InChI | InChI=1S/C10H8Cl2O3.Na.H/c1-5(13)2-9(14)6-3-7(11)8(12)4-10(6)15;;/h3-4,15H,2H2,1H3;;/q;+1;-1 |
| InChIKey | HIIDCQIEKHKERZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|