C12H13BrO5 — CID 154676913
1-[5-bromo-2-hydroxy-4-(methoxymethoxy)phenyl]butane-1,3-dione (PubChem CID 154676913) has the molecular formula C12H13BrO5 and a molecular weight of 317.14 g/mol. Its IUPAC name is 1-[5-bromo-2-hydroxy-4-(methoxymethoxy)phenyl]butane-1,3-dione.
| Compound Name | 1-[5-bromo-2-hydroxy-4-(methoxymethoxy)phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 154676913 |
| Molecular Formula | C12H13BrO5 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 1-[5-bromo-2-hydroxy-4-(methoxymethoxy)phenyl]butane-1,3-dione |
| SMILES | COCOc1cc(O)c(C(=O)CC(C)=O)cc1Br |
| InChI | InChI=1S/C12H13BrO5/c1-7(14)3-10(15)8-4-9(13)12(5-11(8)16)18-6-17-2/h4-5,16H,3,6H2,1-2H3 |
| InChIKey | CPIDOHICPVRXPD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|