C14H21N2+ — CID 20665825
1-methyl-2-[(E)-4-(1-methyl-2,3-dihydropyrrol-2-yl)but-1-enyl]-3H-pyrrol-1-ium (PubChem CID 20665825) has the molecular formula C14H21N2+ and a molecular weight of 217.34 g/mol. Its IUPAC name is 1-methyl-2-[(E)-4-(1-methyl-2,3-dihydropyrrol-2-yl)but-1-enyl]-3H-pyrrol-1-ium.
| Compound Name | 1-methyl-2-[(E)-4-(1-methyl-2,3-dihydropyrrol-2-yl)but-1-enyl]-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 20665825 |
| Molecular Formula | C14H21N2+ |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 1-methyl-2-[(E)-4-(1-methyl-2,3-dihydropyrrol-2-yl)but-1-enyl]-3H-pyrrol-1-ium |
| SMILES | CN1C=CCC1CC/C=C/C1=[N+](C)C=CC1 |
| InChI | InChI=1S/C14H21N2/c1-15-11-5-9-13(15)7-3-4-8-14-10-6-12-16(14)2/h3,5-7,11-12,14H,4,8-10H2,1-2H3/q+1/b7-3+ |
| InChIKey | SCEXTBARBSKLGB-XVNBXDOJSA-N |
| XLogP | 2.54 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|