About methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium
methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium (PubChem CID 159703194) has the molecular formula C14H27N2V+
and a molecular weight of 274.33 g/mol. Its IUPAC name is methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium.
Molecular Properties
| Compound Name | methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium |
| PubChem CID | 159703194 |
| Molecular Formula | C14H27N2V+ |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium |
| SMILES | C.C.C.CN1C=CCC1=CC1=[N+](C)C=CC1.[V] |
| InChI | InChI=1S/C11H15N2.3CH4.V/c1-12-7-3-5-10(12)9-11-6-4-8-13(11)2;;;;/h3-4,7-9H,5-6H2,1-2H3;3*1H4;/q+1;;;; |
| InChIKey | XHJYRFXYWSCZFX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium?
The IUPAC name of methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium (CID 159703194) is methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium.
What is the SMILES notation for methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium?
The canonical SMILES for methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium is C.C.C.CN1C=CCC1=CC1=[N+](C)C=CC1.[V].
What is the InChIKey of methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium?
The InChIKey is XHJYRFXYWSCZFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N2.3CH4.V/c1-12-7-3-5-10(12)9-11-6-4-8-13(11)2;;;;/h3-4,7-9H,5-6H2,1-2H3;3*1H4;/q+1;;;;.
What are the key properties of methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium?
methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium has a molecular weight of 274.33 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-2-[(1-methyl-3H-pyrrol-1-ium-2-yl)methylidene]-3H-pyrrole;vanadium is sourced from PubChem (CID 159703194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).