C15H22O3 — CID 20668764
1',4'a,5'-trimethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one (PubChem CID 20668764) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1',4'a,5'-trimethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one.
| Compound Name | 1',4'a,5'-trimethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 20668764 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1',4'a,5'-trimethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one |
| SMILES | CC1=C2CCC3(OCCO3)C(C)C2(C)CCC1=O |
| InChI | InChI=1S/C15H22O3/c1-10-12-4-7-15(17-8-9-18-15)11(2)14(12,3)6-5-13(10)16/h11H,4-9H2,1-3H3 |
| InChIKey | UYQRROMWDMBWCX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |