C46H52N4O2 — CID 20670437
7-[4-(4-cyanophenyl)phenyl]-N-[2-[7-[4-(4-cyanophenyl)phenyl]heptanoylamino]cyclohexyl]heptanamide (PubChem CID 20670437) has the molecular formula C46H52N4O2 and a molecular weight of 692.95 g/mol. Its IUPAC name is 7-[4-(4-cyanophenyl)phenyl]-N-[2-[7-[4-(4-cyanophenyl)phenyl]heptanoylamino]cyclohexyl]heptanamide.
| Compound Name | 7-[4-(4-cyanophenyl)phenyl]-N-[2-[7-[4-(4-cyanophenyl)phenyl]heptanoylamino]cyclohexyl]heptanamide |
|---|---|
| PubChem CID | 20670437 |
| Molecular Formula | C46H52N4O2 |
| Molecular Weight | 692.95 g/mol |
| Exact Mass | 692.41 |
| IUPAC Name | 7-[4-(4-cyanophenyl)phenyl]-N-[2-[7-[4-(4-cyanophenyl)phenyl]heptanoylamino]cyclohexyl]heptanamide |
| SMILES | N#Cc1ccc(-c2ccc(CCCCCCC(=O)NC3CCCCC3NC(=O)CCCCCCc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H52N4O2/c47-33-37-21-29-41(30-22-37)39-25-17-35(18-26-39)11-5-1-3-7-15-45(51)49-43-13-9-10-14-44(43)50-46(52)16-8-4-2-6-12-36-19-27-40(28-20-36)42-31-23-38(34-48)24-32-42/h17-32,43-44H,1-16H2,(H,49,51)(H,50,52) |
| InChIKey | MPABYYSRYWLXAU-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.95 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|