C35H42N6O4 — CID 11192796
N,N'-bis[1-[(4-cyanophenyl)methyl]-2-oxopiperidin-3-yl]nonanediamide (PubChem CID 11192796) has the molecular formula C35H42N6O4 and a molecular weight of 610.76 g/mol. Its IUPAC name is N,N'-bis[1-[(4-cyanophenyl)methyl]-2-oxopiperidin-3-yl]nonanediamide.
| Compound Name | N,N'-bis[1-[(4-cyanophenyl)methyl]-2-oxopiperidin-3-yl]nonanediamide |
|---|---|
| PubChem CID | 11192796 |
| Molecular Formula | C35H42N6O4 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | N,N'-bis[1-[(4-cyanophenyl)methyl]-2-oxopiperidin-3-yl]nonanediamide |
| SMILES | N#Cc1ccc(CN2CCCC(NC(=O)CCCCCCCC(=O)NC3CCCN(Cc4ccc(C#N)cc4)C3=O)C2=O)cc1 |
| InChI | InChI=1S/C35H42N6O4/c36-22-26-12-16-28(17-13-26)24-40-20-6-8-30(34(40)44)38-32(42)10-4-2-1-3-5-11-33(43)39-31-9-7-21-41(35(31)45)25-29-18-14-27(23-37)15-19-29/h12-19,30-31H,1-11,20-21,24-25H2,(H,38,42)(H,39,43) |
| InChIKey | BFNABZFIJWENGP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 146.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|