C30H40N6O4 — CID 11226606
N,N'-bis[1-[(4-aminophenyl)methyl]-2-oxopiperidin-3-yl]hexanediamide (PubChem CID 11226606) has the molecular formula C30H40N6O4 and a molecular weight of 548.69 g/mol. Its IUPAC name is N,N'-bis[1-[(4-aminophenyl)methyl]-2-oxopiperidin-3-yl]hexanediamide.
| Compound Name | N,N'-bis[1-[(4-aminophenyl)methyl]-2-oxopiperidin-3-yl]hexanediamide |
|---|---|
| PubChem CID | 11226606 |
| Molecular Formula | C30H40N6O4 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | N,N'-bis[1-[(4-aminophenyl)methyl]-2-oxopiperidin-3-yl]hexanediamide |
| SMILES | Nc1ccc(CN2CCCC(NC(=O)CCCCC(=O)NC3CCCN(Cc4ccc(N)cc4)C3=O)C2=O)cc1 |
| InChI | InChI=1S/C30H40N6O4/c31-23-13-9-21(10-14-23)19-35-17-3-5-25(29(35)39)33-27(37)7-1-2-8-28(38)34-26-6-4-18-36(30(26)40)20-22-11-15-24(32)16-12-22/h9-16,25-26H,1-8,17-20,31-32H2,(H,33,37)(H,34,38) |
| InChIKey | DUJKDJABYFIHBN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|