C25H34N2O4S2 — CID 20673552
2-[[3-[(E)-5-amino-2-propan-2-yl-6-sulfanylhex-3-enoxy]naphthalene-2-carbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 20673552) has the molecular formula C25H34N2O4S2 and a molecular weight of 490.69 g/mol. Its IUPAC name is 2-[[3-[(E)-5-amino-2-propan-2-yl-6-sulfanylhex-3-enoxy]naphthalene-2-carbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[3-[(E)-5-amino-2-propan-2-yl-6-sulfanylhex-3-enoxy]naphthalene-2-carbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20673552 |
| Molecular Formula | C25H34N2O4S2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-[[3-[(E)-5-amino-2-propan-2-yl-6-sulfanylhex-3-enoxy]naphthalene-2-carbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1cc2ccccc2cc1OCC(/C=C/C(N)CS)C(C)C)C(=O)O |
| InChI | InChI=1S/C25H34N2O4S2/c1-16(2)19(8-9-20(26)15-32)14-31-23-13-18-7-5-4-6-17(18)12-21(23)24(28)27-22(25(29)30)10-11-33-3/h4-9,12-13,16,19-20,22,32H,10-11,14-15,26H2,1-3H3,(H,27,28)(H,29,30)/b9-8+ |
| InChIKey | YHXZSNRBSNYXIL-CMDGGOBGSA-N |
| XLogP | 4.24 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|