C33H41O4P — CID 20673819
methyl 2-[3-tert-butyl-4-(2,4-ditert-butylbenzo[c][1,2]benzoxaphosphinin-6-yl)oxyphenyl]acetate (PubChem CID 20673819) has the molecular formula C33H41O4P and a molecular weight of 532.66 g/mol. Its IUPAC name is methyl 2-[3-tert-butyl-4-(2,4-ditert-butylbenzo[c][1,2]benzoxaphosphinin-6-yl)oxyphenyl]acetate.
| Compound Name | methyl 2-[3-tert-butyl-4-(2,4-ditert-butylbenzo[c][1,2]benzoxaphosphinin-6-yl)oxyphenyl]acetate |
|---|---|
| PubChem CID | 20673819 |
| Molecular Formula | C33H41O4P |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | methyl 2-[3-tert-butyl-4-(2,4-ditert-butylbenzo[c][1,2]benzoxaphosphinin-6-yl)oxyphenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OP2Oc3c(cc(C(C)(C)C)cc3C(C)(C)C)-c3ccccc32)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H41O4P/c1-31(2,3)22-19-24-23-13-11-12-14-28(23)38(37-30(24)26(20-22)33(7,8)9)36-27-16-15-21(18-29(34)35-10)17-25(27)32(4,5)6/h11-17,19-20H,18H2,1-10H3 |
| InChIKey | PNPSKYCNASKGJZ-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|