C11H18NOP — CID 20677458
4-cyclohexa-1,5-dien-1-yl-1-phosphanylpiperidin-3-ol (PubChem CID 20677458) has the molecular formula C11H18NOP and a molecular weight of 211.24 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-1-phosphanylpiperidin-3-ol.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-1-phosphanylpiperidin-3-ol |
|---|---|
| PubChem CID | 20677458 |
| Molecular Formula | C11H18NOP |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-1-phosphanylpiperidin-3-ol |
| SMILES | OC1CN(P)CCC1C1=CCCC=C1 |
| InChI | InChI=1S/C11H18NOP/c13-11-8-12(14)7-6-10(11)9-4-2-1-3-5-9/h2,4-5,10-11,13H,1,3,6-8,14H2 |
| InChIKey | KYSXVFFFPVKYTG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|