C11H17NO — CID 123244966
4-hexa-1,3,5-trien-3-ylpiperidin-3-ol (PubChem CID 123244966) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-hexa-1,3,5-trien-3-ylpiperidin-3-ol.
| Compound Name | 4-hexa-1,3,5-trien-3-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 123244966 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-hexa-1,3,5-trien-3-ylpiperidin-3-ol |
| SMILES | C=CC=C(C=C)C1CCNCC1O |
| InChI | InChI=1S/C11H17NO/c1-3-5-9(4-2)10-6-7-12-8-11(10)13/h3-5,10-13H,1-2,6-8H2 |
| InChIKey | KBTULTVWAPHREM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|