C12H18FNO — CID 142015597
[4-[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol (PubChem CID 142015597) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is [4-[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol.
| Compound Name | [4-[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 142015597 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | [4-[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol |
| SMILES | C=C/C(F)=C(\C=C)C1(CO)CCNCC1 |
| InChI | InChI=1S/C12H18FNO/c1-3-10(11(13)4-2)12(9-15)5-7-14-8-6-12/h3-4,14-15H,1-2,5-9H2/b11-10- |
| InChIKey | WHRNPXAEYGMISJ-KHPPLWFESA-N |
| XLogP | 1.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|