C15H27NO — CID 143563754
ethane;[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidin-4-yl]methanol (PubChem CID 143563754) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidin-4-yl]methanol.
| Compound Name | ethane;[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 143563754 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | ethane;[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidin-4-yl]methanol |
| SMILES | C=C/C=C(\C=C/C)C1(CO)CCNCC1.CC |
| InChI | InChI=1S/C13H21NO.C2H6/c1-3-5-12(6-4-2)13(11-15)7-9-14-10-8-13;1-2/h3-6,14-15H,1,7-11H2,2H3;1-2H3/b6-4-,12-5+; |
| InChIKey | CAADHFPXKWLBGZ-QRGVYOGNSA-N |
| XLogP | 3.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|