C15H26FNO — CID 142015031
ethane;[4-[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]piperidin-4-yl]methanol (PubChem CID 142015031) has the molecular formula C15H26FNO and a molecular weight of 255.38 g/mol. Its IUPAC name is ethane;[4-[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]piperidin-4-yl]methanol.
| Compound Name | ethane;[4-[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 142015031 |
| Molecular Formula | C15H26FNO |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | ethane;[4-[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]piperidin-4-yl]methanol |
| SMILES | C=C/C(F)=C(\C=C/C)C1(CO)CCNCC1.CC |
| InChI | InChI=1S/C13H20FNO.C2H6/c1-3-5-11(12(14)4-2)13(10-16)6-8-15-9-7-13;1-2/h3-5,15-16H,2,6-10H2,1H3;1-2H3/b5-3-,12-11-; |
| InChIKey | MYLACJURAAIBJY-SGOBWQGDSA-N |
| XLogP | 3.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|