C14H24FNO — CID 142015596
ethane;[4-[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol (PubChem CID 142015596) has the molecular formula C14H24FNO and a molecular weight of 241.35 g/mol. Its IUPAC name is ethane;[4-[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol.
| Compound Name | ethane;[4-[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 142015596 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | ethane;[4-[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol |
| SMILES | C=C/C(F)=C(\C=C)C1(CO)CCNCC1.CC |
| InChI | InChI=1S/C12H18FNO.C2H6/c1-3-10(11(13)4-2)12(9-15)5-7-14-8-6-12;1-2/h3-4,14-15H,1-2,5-9H2;1-2H3/b11-10-; |
| InChIKey | GUSGRVJGCLRVHU-GMFCBQQYSA-N |
| XLogP | 2.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|