C13H18Ac2O4S — CID 20677824
actinium;6-(benzenesulfinyl)-2,5-dimethyloxane-3,4-diol (PubChem CID 20677824) has the molecular formula C13H18Ac2O4S and a molecular weight of 724.35 g/mol. Its IUPAC name is actinium;6-(benzenesulfinyl)-2,5-dimethyloxane-3,4-diol.
| Compound Name | actinium;6-(benzenesulfinyl)-2,5-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 20677824 |
| Molecular Formula | C13H18Ac2O4S |
| Molecular Weight | 724.35 g/mol |
| Exact Mass | 724.15 |
| IUPAC Name | actinium;6-(benzenesulfinyl)-2,5-dimethyloxane-3,4-diol |
| SMILES | CC1OC(S(=O)c2ccccc2)C(C)C(O)C1O.[Ac].[Ac] |
| InChI | InChI=1S/C13H18O4S.2Ac/c1-8-11(14)12(15)9(2)17-13(8)18(16)10-6-4-3-5-7-10;;/h3-9,11-15H,1-2H3;; |
| InChIKey | FVZPKCGZVPNRQC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |