C17H24NO+ — CID 20678137
8-methoxy-1,2,3,4,5,6,7-heptamethylquinolin-1-ium (PubChem CID 20678137) has the molecular formula C17H24NO+ and a molecular weight of 258.38 g/mol. Its IUPAC name is 8-methoxy-1,2,3,4,5,6,7-heptamethylquinolin-1-ium.
| Compound Name | 8-methoxy-1,2,3,4,5,6,7-heptamethylquinolin-1-ium |
|---|---|
| PubChem CID | 20678137 |
| Molecular Formula | C17H24NO+ |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 8-methoxy-1,2,3,4,5,6,7-heptamethylquinolin-1-ium |
| SMILES | COc1c(C)c(C)c(C)c2c(C)c(C)c(C)[n+](C)c12 |
| InChI | InChI=1S/C17H24NO/c1-9-11(3)15-12(4)10(2)14(6)18(7)16(15)17(19-8)13(9)5/h1-8H3/q+1 |
| InChIKey | XUZFVJVNJZNBGL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|