C25H38O3 — CID 91426597
1-(methoxymethoxy)-2,3,4,5,6-pentamethylbenzene;1-methoxy-2,3,4,5,6-pentamethylbenzene (PubChem CID 91426597) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 1-(methoxymethoxy)-2,3,4,5,6-pentamethylbenzene;1-methoxy-2,3,4,5,6-pentamethylbenzene.
| Compound Name | 1-(methoxymethoxy)-2,3,4,5,6-pentamethylbenzene;1-methoxy-2,3,4,5,6-pentamethylbenzene |
|---|---|
| PubChem CID | 91426597 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 1-(methoxymethoxy)-2,3,4,5,6-pentamethylbenzene;1-methoxy-2,3,4,5,6-pentamethylbenzene |
| SMILES | COCOc1c(C)c(C)c(C)c(C)c1C.COc1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C13H20O2.C12H18O/c1-8-9(2)11(4)13(15-7-14-6)12(5)10(8)3;1-7-8(2)10(4)12(13-6)11(5)9(7)3/h7H2,1-6H3;1-6H3 |
| InChIKey | LOXWYRFAPRWRQH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|