C12H17NO7 — CID 14137884
2-methoxy-1,4-bis(methoxymethoxy)-3-methyl-5-nitrobenzene (PubChem CID 14137884) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-methoxy-1,4-bis(methoxymethoxy)-3-methyl-5-nitrobenzene.
| Compound Name | 2-methoxy-1,4-bis(methoxymethoxy)-3-methyl-5-nitrobenzene |
|---|---|
| PubChem CID | 14137884 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-methoxy-1,4-bis(methoxymethoxy)-3-methyl-5-nitrobenzene |
| SMILES | COCOc1cc([N+](=O)[O-])c(OCOC)c(C)c1OC |
| InChI | InChI=1S/C12H17NO7/c1-8-11(20-7-17-3)9(13(14)15)5-10(12(8)18-4)19-6-16-2/h5H,6-7H2,1-4H3 |
| InChIKey | VLCXWXRGFPXSHN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|