C19H29NO8 — CID 11463702
(4R,6R)-7-[2-methoxy-3,6-bis(methoxymethoxy)-5-nitrophenyl]-6-methylhept-1-en-4-ol (PubChem CID 11463702) has the molecular formula C19H29NO8 and a molecular weight of 399.44 g/mol. Its IUPAC name is (4R,6R)-7-[2-methoxy-3,6-bis(methoxymethoxy)-5-nitrophenyl]-6-methylhept-1-en-4-ol.
| Compound Name | (4R,6R)-7-[2-methoxy-3,6-bis(methoxymethoxy)-5-nitrophenyl]-6-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 11463702 |
| Molecular Formula | C19H29NO8 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (4R,6R)-7-[2-methoxy-3,6-bis(methoxymethoxy)-5-nitrophenyl]-6-methylhept-1-en-4-ol |
| SMILES | C=CC[C@@H](O)C[C@H](C)Cc1c(OC)c(OCOC)cc([N+](=O)[O-])c1OCOC |
| InChI | InChI=1S/C19H29NO8/c1-6-7-14(21)8-13(2)9-15-18(28-12-25-4)16(20(22)23)10-17(19(15)26-5)27-11-24-3/h6,10,13-14,21H,1,7-9,11-12H2,2-5H3/t13-,14+/m0/s1 |
| InChIKey | BKPZMKSWTRWWPI-UONOGXRCSA-N |
| XLogP | 3.07 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|