C34H54O13 — CID 19757236
1-butyl-2,5-dimethoxy-3,6-bis(methoxymethoxy)-4-[5-[2,4,5-trimethoxy-3,6-bis(methoxymethoxy)phenyl]pentyl]benzene (PubChem CID 19757236) has the molecular formula C34H54O13 and a molecular weight of 670.79 g/mol. Its IUPAC name is 1-butyl-2,5-dimethoxy-3,6-bis(methoxymethoxy)-4-[5-[2,4,5-trimethoxy-3,6-bis(methoxymethoxy)phenyl]pentyl]benzene.
| Compound Name | 1-butyl-2,5-dimethoxy-3,6-bis(methoxymethoxy)-4-[5-[2,4,5-trimethoxy-3,6-bis(methoxymethoxy)phenyl]pentyl]benzene |
|---|---|
| PubChem CID | 19757236 |
| Molecular Formula | C34H54O13 |
| Molecular Weight | 670.79 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | 1-butyl-2,5-dimethoxy-3,6-bis(methoxymethoxy)-4-[5-[2,4,5-trimethoxy-3,6-bis(methoxymethoxy)phenyl]pentyl]benzene |
| SMILES | CCCCc1c(OC)c(OCOC)c(CCCCCc2c(OCOC)c(OC)c(OC)c(OCOC)c2OC)c(OC)c1OCOC |
| InChI | InChI=1S/C34H54O13/c1-11-12-16-23-26(39-6)30(45-20-36-3)24(27(40-7)29(23)44-19-35-2)17-14-13-15-18-25-28(41-8)34(47-22-38-5)33(43-10)32(42-9)31(25)46-21-37-4/h11-22H2,1-10H3 |
| InChIKey | JDBRZFFPVMWYPW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|