C30H33N5O3S2 — CID 2067835
N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 2067835) has the molecular formula C30H33N5O3S2 and a molecular weight of 575.76 g/mol. Its IUPAC name is N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2067835 |
| Molecular Formula | C30H33N5O3S2 |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CSc2nc3sc4c(c3c(=O)n2-c2ccc(C)cc2)CCCC4)c(O)c1 |
| InChI | InChI=1S/C30H33N5O3S2/c1-4-34(5-2)22-15-12-20(24(36)16-22)17-31-33-26(37)18-39-30-32-28-27(23-8-6-7-9-25(23)40-28)29(38)35(30)21-13-10-19(3)11-14-21/h10-17,36H,4-9,18H2,1-3H3,(H,33,37) |
| InChIKey | ODCDPSUKALYTDQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|