C27H23F3N4O2S2 — CID 6861863
2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 6861863) has the molecular formula C27H23F3N4O2S2 and a molecular weight of 556.64 g/mol. Its IUPAC name is 2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6861863 |
| Molecular Formula | C27H23F3N4O2S2 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)N/N=C/c3ccccc3C(F)(F)F)nc3sc4c(c3c2=O)CCCC4)cc1 |
| InChI | InChI=1S/C27H23F3N4O2S2/c1-16-10-12-18(13-11-16)34-25(36)23-19-7-3-5-9-21(19)38-24(23)32-26(34)37-15-22(35)33-31-14-17-6-2-4-8-20(17)27(28,29)30/h2,4,6,8,10-14H,3,5,7,9,15H2,1H3,(H,33,35)/b31-14+ |
| InChIKey | CZRGELABQKCENB-XAZZYMPDSA-N |
| XLogP | 5.90 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|