C26H22Br2N4O3S2 — CID 4599742
N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 4599742) has the molecular formula C26H22Br2N4O3S2 and a molecular weight of 662.43 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4599742 |
| Molecular Formula | C26H22Br2N4O3S2 |
| Molecular Weight | 662.43 g/mol |
| Exact Mass | 659.95 |
| IUPAC Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)NN=Cc3cc(Br)cc(Br)c3O)nc3sc4c(c3c2=O)CCCC4)cc1 |
| InChI | InChI=1S/C26H22Br2N4O3S2/c1-14-6-8-17(9-7-14)32-25(35)22-18-4-2-3-5-20(18)37-24(22)30-26(32)36-13-21(33)31-29-12-15-10-16(27)11-19(28)23(15)34/h6-12,34H,2-5,13H2,1H3,(H,31,33) |
| InChIKey | ORVZHDNIAJBDNJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|