C34H58O7 — CID 20679937
2-ethyl-2,4,6,8,8-pentamethyl-4-(oxan-2-yloxycarbonyl)-9-oxo-9-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]nonanoic acid (PubChem CID 20679937) has the molecular formula C34H58O7 and a molecular weight of 578.83 g/mol. Its IUPAC name is 2-ethyl-2,4,6,8,8-pentamethyl-4-(oxan-2-yloxycarbonyl)-9-oxo-9-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]nonanoic acid.
| Compound Name | 2-ethyl-2,4,6,8,8-pentamethyl-4-(oxan-2-yloxycarbonyl)-9-oxo-9-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]nonanoic acid |
|---|---|
| PubChem CID | 20679937 |
| Molecular Formula | C34H58O7 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | 2-ethyl-2,4,6,8,8-pentamethyl-4-(oxan-2-yloxycarbonyl)-9-oxo-9-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]nonanoic acid |
| SMILES | CCC(C)(CC(C)(CC(C)CC(C)(C)C(=O)OC1(C)CC2(C)CCC1(C)C2(C)C)C(=O)OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C34H58O7/c1-12-30(7,25(35)36)21-31(8,27(38)40-24-15-13-14-18-39-24)20-23(2)19-28(3,4)26(37)41-34(11)22-32(9)16-17-33(34,10)29(32,5)6/h23-24H,12-22H2,1-11H3,(H,35,36) |
| InChIKey | WKVXASQABFRZIG-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |