C29H42Cl2O8 — CID 20680006
1-O-(oxan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[(3,4-dichloro-4-methyl-2,5-dioxooxolan-3-yl)methyl]-2,2,4-trimethylpentanedioate (PubChem CID 20680006) has the molecular formula C29H42Cl2O8 and a molecular weight of 589.55 g/mol. Its IUPAC name is 1-O-(oxan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[(3,4-dichloro-4-methyl-2,5-dioxooxolan-3-yl)methyl]-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(oxan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[(3,4-dichloro-4-methyl-2,5-dioxooxolan-3-yl)methyl]-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 20680006 |
| Molecular Formula | C29H42Cl2O8 |
| Molecular Weight | 589.55 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 1-O-(oxan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[(3,4-dichloro-4-methyl-2,5-dioxooxolan-3-yl)methyl]-2,2,4-trimethylpentanedioate |
| SMILES | CC(C)(CC(C)(CC1(Cl)C(=O)OC(=O)C1(C)Cl)C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)OC1CCCCO1 |
| InChI | InChI=1S/C29H42Cl2O8/c1-24(2,20(32)38-19-10-8-9-13-36-19)15-26(5,16-29(31)23(35)39-22(34)28(29,7)30)21(33)37-18-14-17-11-12-27(18,6)25(17,3)4/h17-19H,8-16H2,1-7H3 |
| InChIKey | WZGXEOIOOPTHGG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|