C27H31FN2O — CID 20680448
1-ethyl-4-[3-(1-fluoro-2-phenylethyl)-4-methoxy-5-phenylphenyl]piperazine (PubChem CID 20680448) has the molecular formula C27H31FN2O and a molecular weight of 418.56 g/mol. Its IUPAC name is 1-ethyl-4-[3-(1-fluoro-2-phenylethyl)-4-methoxy-5-phenylphenyl]piperazine.
| Compound Name | 1-ethyl-4-[3-(1-fluoro-2-phenylethyl)-4-methoxy-5-phenylphenyl]piperazine |
|---|---|
| PubChem CID | 20680448 |
| Molecular Formula | C27H31FN2O |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-ethyl-4-[3-(1-fluoro-2-phenylethyl)-4-methoxy-5-phenylphenyl]piperazine |
| SMILES | CCN1CCN(c2cc(-c3ccccc3)c(OC)c(C(F)Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C27H31FN2O/c1-3-29-14-16-30(17-15-29)23-19-24(22-12-8-5-9-13-22)27(31-2)25(20-23)26(28)18-21-10-6-4-7-11-21/h4-13,19-20,26H,3,14-18H2,1-2H3 |
| InChIKey | FDQDVXWBZFFEQF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|