C15H15F3N4O4S — CID 20680586
(3S)-1-[(7-aminothieno[2,3-c]pyridin-3-yl)methyl]-2-oxopyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 20680586) has the molecular formula C15H15F3N4O4S and a molecular weight of 404.37 g/mol. Its IUPAC name is (3S)-1-[(7-aminothieno[2,3-c]pyridin-3-yl)methyl]-2-oxopyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3S)-1-[(7-aminothieno[2,3-c]pyridin-3-yl)methyl]-2-oxopyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 20680586 |
| Molecular Formula | C15H15F3N4O4S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (3S)-1-[(7-aminothieno[2,3-c]pyridin-3-yl)methyl]-2-oxopyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)[C@@H]1CCN(Cc2csc3c(N)nccc23)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H14N4O2S.C2HF3O2/c14-11-10-8(1-3-16-11)7(6-20-10)5-17-4-2-9(12(15)18)13(17)19;3-2(4,5)1(6)7/h1,3,6,9H,2,4-5H2,(H2,14,16)(H2,15,18);(H,6,7)/t9-;/m0./s1 |
| InChIKey | HNAIWCYICNKKCI-FVGYRXGTSA-N |
| XLogP | 1.35 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|