C13H12ClN3O2S — CID 18176283
1-[(4-chlorothieno[3,2-c]pyridin-3-yl)methyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 18176283) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is 1-[(4-chlorothieno[3,2-c]pyridin-3-yl)methyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[(4-chlorothieno[3,2-c]pyridin-3-yl)methyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 18176283 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 1-[(4-chlorothieno[3,2-c]pyridin-3-yl)methyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(Cc2csc3ccnc(Cl)c23)C1=O |
| InChI | InChI=1S/C13H12ClN3O2S/c14-11-10-7(6-20-9(10)1-3-16-11)5-17-4-2-8(12(15)18)13(17)19/h1,3,6,8H,2,4-5H2,(H2,15,18) |
| InChIKey | AJTVQMKRQHWNSH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|