C13H13N3O3S — CID 70024630
(3R)-2-oxo-1-[(4-oxo-5H-thieno[3,2-c]pyridin-3-yl)methyl]pyrrolidine-3-carboxamide (PubChem CID 70024630) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is (3R)-2-oxo-1-[(4-oxo-5H-thieno[3,2-c]pyridin-3-yl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-2-oxo-1-[(4-oxo-5H-thieno[3,2-c]pyridin-3-yl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 70024630 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (3R)-2-oxo-1-[(4-oxo-5H-thieno[3,2-c]pyridin-3-yl)methyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCN(Cc2csc3cc[nH]c(=O)c23)C1=O |
| InChI | InChI=1S/C13H13N3O3S/c14-11(17)8-2-4-16(13(8)19)5-7-6-20-9-1-3-15-12(18)10(7)9/h1,3,6,8H,2,4-5H2,(H2,14,17)(H,15,18)/t8-/m1/s1 |
| InChIKey | YKPSSPROQVINNU-MRVPVSSYSA-N |
| XLogP | 0.42 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|