C19H19N3OS2 — CID 20685295
2-[5-(1H-benzimidazol-2-ylsulfanyl)pentylsulfanyl]-1,3-benzoxazole (PubChem CID 20685295) has the molecular formula C19H19N3OS2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[5-(1H-benzimidazol-2-ylsulfanyl)pentylsulfanyl]-1,3-benzoxazole.
| Compound Name | 2-[5-(1H-benzimidazol-2-ylsulfanyl)pentylsulfanyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 20685295 |
| Molecular Formula | C19H19N3OS2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[5-(1H-benzimidazol-2-ylsulfanyl)pentylsulfanyl]-1,3-benzoxazole |
| SMILES | c1ccc2[nH]c(SCCCCCSc3nc4ccccc4o3)nc2c1 |
| InChI | InChI=1S/C19H19N3OS2/c1(6-12-24-18-20-14-8-2-3-9-15(14)21-18)7-13-25-19-22-16-10-4-5-11-17(16)23-19/h2-5,8-11H,1,6-7,12-13H2,(H,20,21) |
| InChIKey | ONEZOKQRFYFSGW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|