C7H12OS2 — CID 20686902
7-methyl-1,5-dithiocan-3-one (PubChem CID 20686902) has the molecular formula C7H12OS2 and a molecular weight of 176.31 g/mol. Its IUPAC name is 7-methyl-1,5-dithiocan-3-one.
| Compound Name | 7-methyl-1,5-dithiocan-3-one |
|---|---|
| PubChem CID | 20686902 |
| Molecular Formula | C7H12OS2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 7-methyl-1,5-dithiocan-3-one |
| SMILES | CC1CSCC(=O)CSC1 |
| InChI | InChI=1S/C7H12OS2/c1-6-2-9-4-7(8)5-10-3-6/h6H,2-5H2,1H3 |
| InChIKey | DFIIIRZGAPQRDG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |