C9H14N2OS — CID 126975805
2-(2,4-dimethylpyrrolidin-1-yl)-1,3-thiazol-4-one (PubChem CID 126975805) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-(2,4-dimethylpyrrolidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 2-(2,4-dimethylpyrrolidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 126975805 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-(2,4-dimethylpyrrolidin-1-yl)-1,3-thiazol-4-one |
| SMILES | CC1CC(C)N(C2=NC(=O)CS2)C1 |
| InChI | InChI=1S/C9H14N2OS/c1-6-3-7(2)11(4-6)9-10-8(12)5-13-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | VXHVLJBEBZOORG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |