C14H20O8 — CID 20689649
7-(hydroperoxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,5-tricarboxylic acid (PubChem CID 20689649) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is 7-(hydroperoxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,5-tricarboxylic acid.
| Compound Name | 7-(hydroperoxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 20689649 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 7-(hydroperoxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,5-tricarboxylic acid |
| SMILES | O=C(O)C1CC(C(=O)O)C2CC(COO)CC(C(=O)O)C2C1 |
| InChI | InChI=1S/C14H20O8/c15-12(16)7-3-9-8(11(4-7)14(19)20)1-6(5-22-21)2-10(9)13(17)18/h6-11,21H,1-5H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | QDGVXOIYNAVNPJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|